C24H26N4O5 — CID 53311321
4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenol;1,3,7-trimethylpurine-2,6-dione (PubChem CID 53311321) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenol;1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenol;1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 53311321 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenol;1,3,7-trimethylpurine-2,6-dione |
| SMILES | COc1cc(/C=C/c2ccc(O)cc2)cc(OC)c1.Cn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C16H16O3.C8H10N4O2/c1-18-15-9-13(10-16(11-15)19-2)4-3-12-5-7-14(17)8-6-12;1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h3-11,17H,1-2H3;4H,1-3H3/b4-3+; |
| InChIKey | BJOVZNLNOLOOIU-BJILWQEISA-N |
| XLogP | 2.55 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|