C33H26N6O4 — CID 53311694
N-[4-(1,3-benzoxazol-2-ylmethylamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide (PubChem CID 53311694) has the molecular formula C33H26N6O4 and a molecular weight of 570.61 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-ylmethylamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide.
| Compound Name | N-[4-(1,3-benzoxazol-2-ylmethylamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 53311694 |
| Molecular Formula | C33H26N6O4 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-ylmethylamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide |
| SMILES | O=C(NCc1nc2ccccc2o1)C(=O)C(Cc1ccccc1)NC(=O)c1cccnc1-n1ccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C33H26N6O4/c40-30(33(42)35-21-29-36-26-15-7-8-16-28(26)43-29)27(20-22-10-3-1-4-11-22)37-32(41)24-14-9-18-34-31(24)39-19-17-25(38-39)23-12-5-2-6-13-23/h1-19,27H,20-21H2,(H,35,42)(H,37,41) |
| InChIKey | VUAQDUSCRRQJIZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 132.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|