C33H29N5O3 — CID 53311695
N-[3,4-dioxo-1-phenyl-4-(2-phenylethylamino)butan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide (PubChem CID 53311695) has the molecular formula C33H29N5O3 and a molecular weight of 543.63 g/mol. Its IUPAC name is N-[3,4-dioxo-1-phenyl-4-(2-phenylethylamino)butan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide.
| Compound Name | N-[3,4-dioxo-1-phenyl-4-(2-phenylethylamino)butan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 53311695 |
| Molecular Formula | C33H29N5O3 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | N-[3,4-dioxo-1-phenyl-4-(2-phenylethylamino)butan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide |
| SMILES | O=C(NCCc1ccccc1)C(=O)C(Cc1ccccc1)NC(=O)c1cccnc1-n1ccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C33H29N5O3/c39-30(33(41)35-21-18-24-11-4-1-5-12-24)29(23-25-13-6-2-7-14-25)36-32(40)27-17-10-20-34-31(27)38-22-19-28(37-38)26-15-8-3-9-16-26/h1-17,19-20,22,29H,18,21,23H2,(H,35,41)(H,36,40) |
| InChIKey | IBDSFAKHCBRYCF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|