C18H16F4N4O3 — CID 53311820
3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-N-[3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]propyl]propanamide (PubChem CID 53311820) has the molecular formula C18H16F4N4O3 and a molecular weight of 412.34 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-N-[3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]propyl]propanamide.
| Compound Name | 3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-N-[3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]propyl]propanamide |
|---|---|
| PubChem CID | 53311820 |
| Molecular Formula | C18H16F4N4O3 |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-N-[3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]propyl]propanamide |
| SMILES | O=C(CCc1coc(-c2ccc(F)cc2)n1)NCCCc1noc(C(F)(F)F)n1 |
| InChI | InChI=1S/C18H16F4N4O3/c19-12-5-3-11(4-6-12)16-24-13(10-28-16)7-8-15(27)23-9-1-2-14-25-17(29-26-14)18(20,21)22/h3-6,10H,1-2,7-9H2,(H,23,27) |
| InChIKey | ZCLAOXCBBXODIX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|