C13H12N2O3S3 — CID 5331210
(5Z)-3-(1,1-dioxothiolan-3-yl)-5-(pyridin-4-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 5331210) has the molecular formula C13H12N2O3S3 and a molecular weight of 340.45 g/mol. Its IUPAC name is (5Z)-3-(1,1-dioxothiolan-3-yl)-5-(pyridin-4-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(1,1-dioxothiolan-3-yl)-5-(pyridin-4-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5331210 |
| Molecular Formula | C13H12N2O3S3 |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | (5Z)-3-(1,1-dioxothiolan-3-yl)-5-(pyridin-4-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccncc2)SC(=S)N1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H12N2O3S3/c16-12-11(7-9-1-4-14-5-2-9)20-13(19)15(12)10-3-6-21(17,18)8-10/h1-2,4-5,7,10H,3,6,8H2/b11-7- |
| InChIKey | PHPRQMHXHIMMIV-XFFZJAGNSA-N |
| XLogP | 1.47 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|