About methyl 4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate
methyl 4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate (PubChem CID 5331231) has the molecular formula C18H15N3O2S
and a molecular weight of 337.40 g/mol. Its IUPAC name is methyl 4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate |
| PubChem CID | 5331231 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | methyl 4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/Nc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C18H15N3O2S/c1-23-17(22)15-9-7-13(8-10-15)11-19-21-18-20-16(12-24-18)14-5-3-2-4-6-14/h2-12H,1H3,(H,20,21)/b19-11+ |
| InChIKey | JNGGCUKAMAPQNX-YBFXNURJSA-N |
| XLogP | 4.04 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate?
The IUPAC name of methyl 4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate (CID 5331231) is methyl 4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate.
What is the SMILES notation for methyl 4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate?
The canonical SMILES for methyl 4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate is COC(=O)c1ccc(/C=N/Nc2nc(-c3ccccc3)cs2)cc1.
What is the InChIKey of methyl 4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate?
The InChIKey is JNGGCUKAMAPQNX-YBFXNURJSA-N. The full InChI is InChI=1S/C18H15N3O2S/c1-23-17(22)15-9-7-13(8-10-15)11-19-21-18-20-16(12-24-18)14-5-3-2-4-6-14/h2-12H,1H3,(H,20,21)/b19-11+.
What are the key properties of methyl 4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate?
methyl 4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate has a molecular weight of 337.40 g/mol, XLogP of 4.04, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(E)-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate is sourced from PubChem (CID 5331231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).