About N-[4-propan-2-yl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]pyridine-3-carboxamide
N-[4-propan-2-yl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]pyridine-3-carboxamide (PubChem CID 53312315) has the molecular formula C22H25N5OS
and a molecular weight of 407.54 g/mol. Its IUPAC name is N-[4-propan-2-yl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[4-propan-2-yl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]pyridine-3-carboxamide |
| PubChem CID | 53312315 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-[4-propan-2-yl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]pyridine-3-carboxamide |
| SMILES | CC(C)c1ccc(NC(=O)c2cccnc2)c(N2CCN(c3nccs3)CC2)c1 |
| InChI | InChI=1S/C22H25N5OS/c1-16(2)17-5-6-19(25-21(28)18-4-3-7-23-15-18)20(14-17)26-9-11-27(12-10-26)22-24-8-13-29-22/h3-8,13-16H,9-12H2,1-2H3,(H,25,28) |
| InChIKey | XJODWNGVERGAGS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-propan-2-yl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-propan-2-yl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]pyridine-3-carboxamide?
The IUPAC name of N-[4-propan-2-yl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]pyridine-3-carboxamide (CID 53312315) is N-[4-propan-2-yl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]pyridine-3-carboxamide.
What is the SMILES notation for N-[4-propan-2-yl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]pyridine-3-carboxamide?
The canonical SMILES for N-[4-propan-2-yl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]pyridine-3-carboxamide is CC(C)c1ccc(NC(=O)c2cccnc2)c(N2CCN(c3nccs3)CC2)c1.
What is the InChIKey of N-[4-propan-2-yl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]pyridine-3-carboxamide?
The InChIKey is XJODWNGVERGAGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N5OS/c1-16(2)17-5-6-19(25-21(28)18-4-3-7-23-15-18)20(14-17)26-9-11-27(12-10-26)22-24-8-13-29-22/h3-8,13-16H,9-12H2,1-2H3,(H,25,28).
What are the key properties of N-[4-propan-2-yl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]pyridine-3-carboxamide?
N-[4-propan-2-yl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]pyridine-3-carboxamide has a molecular weight of 407.54 g/mol, XLogP of 4.24, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-propan-2-yl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]pyridine-3-carboxamide is sourced from PubChem (CID 53312315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).