C16H24ClN2O2- — CID 53312695
[4-(2-hydroxyethyl)piperazin-1-yl]-(4-propan-2-ylphenyl)methanone chloride (PubChem CID 53312695) has the molecular formula C16H24ClN2O2- and a molecular weight of 311.83 g/mol. Its IUPAC name is [4-(2-hydroxyethyl)piperazin-1-yl]-(4-propan-2-ylphenyl)methanone chloride.
| Compound Name | [4-(2-hydroxyethyl)piperazin-1-yl]-(4-propan-2-ylphenyl)methanone chloride |
|---|---|
| PubChem CID | 53312695 |
| Molecular Formula | C16H24ClN2O2- |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [4-(2-hydroxyethyl)piperazin-1-yl]-(4-propan-2-ylphenyl)methanone chloride |
| SMILES | CC(C)c1ccc(C(=O)N2CCN(CCO)CC2)cc1.[Cl-] |
| InChI | InChI=1S/C16H24N2O2.ClH/c1-13(2)14-3-5-15(6-4-14)16(20)18-9-7-17(8-10-18)11-12-19;/h3-6,13,19H,7-12H2,1-2H3;1H/p-1 |
| InChIKey | BVDFQEKIPFWGDL-UHFFFAOYSA-M |
| XLogP | -1.44 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |