C27H25Cl2F3N2O6 — CID 53312877
methyl (3aS,4S,9aS,9bR)-4-[4-(3,4-dichlorophenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 53312877) has the molecular formula C27H25Cl2F3N2O6 and a molecular weight of 601.41 g/mol. Its IUPAC name is methyl (3aS,4S,9aS,9bR)-4-[4-(3,4-dichlorophenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (3aS,4S,9aS,9bR)-4-[4-(3,4-dichlorophenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 53312877 |
| Molecular Formula | C27H25Cl2F3N2O6 |
| Molecular Weight | 601.41 g/mol |
| Exact Mass | 600.10 |
| IUPAC Name | methyl (3aS,4S,9aS,9bR)-4-[4-(3,4-dichlorophenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)[C@@]12CCCCN1[C@H](c1ccc(-c3ccc(Cl)c(Cl)c3)cc1)[C@H]1C(=O)N(C)C(=O)[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H24Cl2N2O4.C2HF3O2/c1-28-22(30)19-20(23(28)31)25(24(32)33-2)11-3-4-12-29(25)21(19)15-7-5-14(6-8-15)16-9-10-17(26)18(27)13-16;3-2(4,5)1(6)7/h5-10,13,19-21H,3-4,11-12H2,1-2H3;(H,6,7)/t19-,20-,21+,25-;/m0./s1 |
| InChIKey | ODOGITCCXPRPNQ-MNRJGUIWSA-N |
| XLogP | 4.98 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.41 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|