About 3-[1-[(2S,3R)-3-methyl-1-oxo-1-piperazin-1-ylpentan-2-yl]triazol-4-yl]propanoic acid chloride
3-[1-[(2S,3R)-3-methyl-1-oxo-1-piperazin-1-ylpentan-2-yl]triazol-4-yl]propanoic acid chloride (PubChem CID 53312896) has the molecular formula C15H25ClN5O3-
and a molecular weight of 358.85 g/mol. Its IUPAC name is 3-[1-[(2S,3R)-3-methyl-1-oxo-1-piperazin-1-ylpentan-2-yl]triazol-4-yl]propanoic acid chloride.
Molecular Properties
| Compound Name | 3-[1-[(2S,3R)-3-methyl-1-oxo-1-piperazin-1-ylpentan-2-yl]triazol-4-yl]propanoic acid chloride |
| PubChem CID | 53312896 |
| Molecular Formula | C15H25ClN5O3- |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 3-[1-[(2S,3R)-3-methyl-1-oxo-1-piperazin-1-ylpentan-2-yl]triazol-4-yl]propanoic acid chloride |
| SMILES | CC[C@@H](C)[C@@H](C(=O)N1CCNCC1)n1cc(CCC(=O)O)nn1.[Cl-] |
| InChI | InChI=1S/C15H25N5O3.ClH/c1-3-11(2)14(15(23)19-8-6-16-7-9-19)20-10-12(17-18-20)4-5-13(21)22;/h10-11,14,16H,3-9H2,1-2H3,(H,21,22);1H/p-1/t11-,14+;/m1./s1 |
| InChIKey | LFCVJLAZQTUBQC-GGMFNZDASA-M |
| XLogP | -2.68 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[1-[(2S,3R)-3-methyl-1-oxo-1-piperazin-1-ylpentan-2-yl]triazol-4-yl]propanoic acid chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[(2S,3R)-3-methyl-1-oxo-1-piperazin-1-ylpentan-2-yl]triazol-4-yl]propanoic acid chloride?
The IUPAC name of 3-[1-[(2S,3R)-3-methyl-1-oxo-1-piperazin-1-ylpentan-2-yl]triazol-4-yl]propanoic acid chloride (CID 53312896) is 3-[1-[(2S,3R)-3-methyl-1-oxo-1-piperazin-1-ylpentan-2-yl]triazol-4-yl]propanoic acid chloride.
What is the SMILES notation for 3-[1-[(2S,3R)-3-methyl-1-oxo-1-piperazin-1-ylpentan-2-yl]triazol-4-yl]propanoic acid chloride?
The canonical SMILES for 3-[1-[(2S,3R)-3-methyl-1-oxo-1-piperazin-1-ylpentan-2-yl]triazol-4-yl]propanoic acid chloride is CC[C@@H](C)[C@@H](C(=O)N1CCNCC1)n1cc(CCC(=O)O)nn1.[Cl-].
What is the InChIKey of 3-[1-[(2S,3R)-3-methyl-1-oxo-1-piperazin-1-ylpentan-2-yl]triazol-4-yl]propanoic acid chloride?
The InChIKey is LFCVJLAZQTUBQC-GGMFNZDASA-M. The full InChI is InChI=1S/C15H25N5O3.ClH/c1-3-11(2)14(15(23)19-8-6-16-7-9-19)20-10-12(17-18-20)4-5-13(21)22;/h10-11,14,16H,3-9H2,1-2H3,(H,21,22);1H/p-1/t11-,14+;/m1./s1.
What are the key properties of 3-[1-[(2S,3R)-3-methyl-1-oxo-1-piperazin-1-ylpentan-2-yl]triazol-4-yl]propanoic acid chloride?
3-[1-[(2S,3R)-3-methyl-1-oxo-1-piperazin-1-ylpentan-2-yl]triazol-4-yl]propanoic acid chloride has a molecular weight of 358.85 g/mol, XLogP of -2.68, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[(2S,3R)-3-methyl-1-oxo-1-piperazin-1-ylpentan-2-yl]triazol-4-yl]propanoic acid chloride is sourced from PubChem (CID 53312896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).