C27H30F3N7O3 — CID 53312967
N-[4-[methyl-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide;2,2,2-trifluoroacetic acid (PubChem CID 53312967) has the molecular formula C27H30F3N7O3 and a molecular weight of 557.58 g/mol. Its IUPAC name is N-[4-[methyl-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[4-[methyl-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 53312967 |
| Molecular Formula | C27H30F3N7O3 |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | N-[4-[methyl-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide;2,2,2-trifluoroacetic acid |
| SMILES | C=CC(=O)Nc1ccc(N(C)c2ccnc(Nc3ccc(N4CCN(C)CC4)cc3)n2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H29N7O.C2HF3O2/c1-4-24(33)27-19-5-9-21(10-6-19)31(3)23-13-14-26-25(29-23)28-20-7-11-22(12-8-20)32-17-15-30(2)16-18-32;3-2(4,5)1(6)7/h4-14H,1,15-18H2,2-3H3,(H,27,33)(H,26,28,29);(H,6,7) |
| InChIKey | RKUBBVKEUJSYAL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|