C20H15F3N4O2 — CID 53313113
3-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)aniline;2,2,2-trifluoroacetic acid (PubChem CID 53313113) has the molecular formula C20H15F3N4O2 and a molecular weight of 400.36 g/mol. Its IUPAC name is 3-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)aniline;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)aniline;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 53313113 |
| Molecular Formula | C20H15F3N4O2 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 3-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)aniline;2,2,2-trifluoroacetic acid |
| SMILES | Nc1cccc(-c2c[nH]c3ncc(-c4cccnc4)cc23)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H14N4.C2HF3O2/c19-15-5-1-3-12(7-15)17-11-22-18-16(17)8-14(10-21-18)13-4-2-6-20-9-13;3-2(4,5)1(6)7/h1-11H,19H2,(H,21,22);(H,6,7) |
| InChIKey | AFAMRGDGXTWCJV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|