About (2S)-2-amino-2-methyl-4-phosphonobutanoic acid chloride
(2S)-2-amino-2-methyl-4-phosphonobutanoic acid chloride (PubChem CID 53313139) has the molecular formula C5H12ClNO5P-
and a molecular weight of 232.58 g/mol. Its IUPAC name is (2S)-2-amino-2-methyl-4-phosphonobutanoic acid chloride.
Molecular Properties
| Compound Name | (2S)-2-amino-2-methyl-4-phosphonobutanoic acid chloride |
| PubChem CID | 53313139 |
| Molecular Formula | C5H12ClNO5P- |
| Molecular Weight | 232.58 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | (2S)-2-amino-2-methyl-4-phosphonobutanoic acid chloride |
| SMILES | C[C@](N)(CCP(=O)(O)O)C(=O)O.[Cl-] |
| InChI | InChI=1S/C5H12NO5P.ClH/c1-5(6,4(7)8)2-3-12(9,10)11;/h2-3,6H2,1H3,(H,7,8)(H2,9,10,11);1H/p-1/t5-;/m0./s1 |
| InChIKey | DNFXUQUECNSSJF-JEDNCBNOSA-M |
| XLogP | -3.64 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.58 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-2-methyl-4-phosphonobutanoic acid chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-2-methyl-4-phosphonobutanoic acid chloride?
The IUPAC name of (2S)-2-amino-2-methyl-4-phosphonobutanoic acid chloride (CID 53313139) is (2S)-2-amino-2-methyl-4-phosphonobutanoic acid chloride.
What is the SMILES notation for (2S)-2-amino-2-methyl-4-phosphonobutanoic acid chloride?
The canonical SMILES for (2S)-2-amino-2-methyl-4-phosphonobutanoic acid chloride is C[C@](N)(CCP(=O)(O)O)C(=O)O.[Cl-].
What is the InChIKey of (2S)-2-amino-2-methyl-4-phosphonobutanoic acid chloride?
The InChIKey is DNFXUQUECNSSJF-JEDNCBNOSA-M. The full InChI is InChI=1S/C5H12NO5P.ClH/c1-5(6,4(7)8)2-3-12(9,10)11;/h2-3,6H2,1H3,(H,7,8)(H2,9,10,11);1H/p-1/t5-;/m0./s1.
What are the key properties of (2S)-2-amino-2-methyl-4-phosphonobutanoic acid chloride?
(2S)-2-amino-2-methyl-4-phosphonobutanoic acid chloride has a molecular weight of 232.58 g/mol, XLogP of -3.64, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-2-methyl-4-phosphonobutanoic acid chloride is sourced from PubChem (CID 53313139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).