C21H28N4O5S — CID 53313340
(3S)-3-[[(2S)-4-[2-(2-methylbenzimidazol-1-yl)ethylamino]-4-oxo-2-propan-2-ylbutanoyl]amino]-4-oxo-4-sulfanylbutanoic acid (PubChem CID 53313340) has the molecular formula C21H28N4O5S and a molecular weight of 448.55 g/mol. Its IUPAC name is (3S)-3-[[(2S)-4-[2-(2-methylbenzimidazol-1-yl)ethylamino]-4-oxo-2-propan-2-ylbutanoyl]amino]-4-oxo-4-sulfanylbutanoic acid.
| Compound Name | (3S)-3-[[(2S)-4-[2-(2-methylbenzimidazol-1-yl)ethylamino]-4-oxo-2-propan-2-ylbutanoyl]amino]-4-oxo-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 53313340 |
| Molecular Formula | C21H28N4O5S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | (3S)-3-[[(2S)-4-[2-(2-methylbenzimidazol-1-yl)ethylamino]-4-oxo-2-propan-2-ylbutanoyl]amino]-4-oxo-4-sulfanylbutanoic acid |
| SMILES | Cc1nc2ccccc2n1CCNC(=O)C[C@H](C(=O)N[C@@H](CC(=O)O)C(=O)S)C(C)C |
| InChI | InChI=1S/C21H28N4O5S/c1-12(2)14(20(29)24-16(21(30)31)11-19(27)28)10-18(26)22-8-9-25-13(3)23-15-6-4-5-7-17(15)25/h4-7,12,14,16H,8-11H2,1-3H3,(H,22,26)(H,24,29)(H,27,28)(H,30,31)/t14-,16-/m0/s1 |
| InChIKey | YQOKHWAJMULTKH-HOCLYGCPSA-N |
| XLogP | 1.54 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|