About N,N-dihexyloctanamide
N,N-dihexyloctanamide (PubChem CID 533135) has the molecular formula C20H41NO
and a molecular weight of 311.55 g/mol. Its IUPAC name is N,N-dihexyloctanamide.
Molecular Properties
| Compound Name | N,N-dihexyloctanamide |
| PubChem CID | 533135 |
| Molecular Formula | C20H41NO |
| Molecular Weight | 311.55 g/mol |
| Exact Mass | 311.32 |
| IUPAC Name | N,N-dihexyloctanamide |
| SMILES | CCCCCCCC(=O)N(CCCCCC)CCCCCC |
| InChI | InChI=1S/C20H41NO/c1-4-7-10-13-14-17-20(22)21(18-15-11-8-5-2)19-16-12-9-6-3/h4-19H2,1-3H3 |
| InChIKey | ZFDFITYPADKELQ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.55 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-dihexyloctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dihexyloctanamide?
The IUPAC name of N,N-dihexyloctanamide (CID 533135) is N,N-dihexyloctanamide.
What is the SMILES notation for N,N-dihexyloctanamide?
The canonical SMILES for N,N-dihexyloctanamide is CCCCCCCC(=O)N(CCCCCC)CCCCCC.
What is the InChIKey of N,N-dihexyloctanamide?
The InChIKey is ZFDFITYPADKELQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41NO/c1-4-7-10-13-14-17-20(22)21(18-15-11-8-5-2)19-16-12-9-6-3/h4-19H2,1-3H3.
What are the key properties of N,N-dihexyloctanamide?
N,N-dihexyloctanamide has a molecular weight of 311.55 g/mol, XLogP of 6.34, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dihexyloctanamide is sourced from PubChem (CID 533135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).