About N-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]acetamide
N-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]acetamide (PubChem CID 5331368) has the molecular formula C16H16N2O2
and a molecular weight of 268.32 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]acetamide.
Molecular Properties
| Compound Name | N-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]acetamide |
| PubChem CID | 5331368 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]acetamide |
| SMILES | CC(=O)N/N=C(/c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O2/c1-12(19)17-18-15(13-8-4-2-5-9-13)16(20)14-10-6-3-7-11-14/h2-11,16,20H,1H3,(H,17,19)/b18-15- |
| InChIKey | KCJTYKLQLRXRTM-SDXDJHTJSA-N |
| XLogP | 2.26 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]acetamide?
The IUPAC name of N-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]acetamide (CID 5331368) is N-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]acetamide.
What is the SMILES notation for N-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]acetamide?
The canonical SMILES for N-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]acetamide is CC(=O)N/N=C(/c1ccccc1)C(O)c1ccccc1.
What is the InChIKey of N-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]acetamide?
The InChIKey is KCJTYKLQLRXRTM-SDXDJHTJSA-N. The full InChI is InChI=1S/C16H16N2O2/c1-12(19)17-18-15(13-8-4-2-5-9-13)16(20)14-10-6-3-7-11-14/h2-11,16,20H,1H3,(H,17,19)/b18-15-.
What are the key properties of N-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]acetamide?
N-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]acetamide has a molecular weight of 268.32 g/mol, XLogP of 2.26, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]acetamide is sourced from PubChem (CID 5331368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).