About 4-methyl-3-methylsulfanyl-5-pyrrolidin-2-yl-1,2,4-triazole chloride
4-methyl-3-methylsulfanyl-5-pyrrolidin-2-yl-1,2,4-triazole chloride (PubChem CID 53314302) has the molecular formula C8H14ClN4S-
and a molecular weight of 233.75 g/mol. Its IUPAC name is 4-methyl-3-methylsulfanyl-5-pyrrolidin-2-yl-1,2,4-triazole chloride.
Molecular Properties
| Compound Name | 4-methyl-3-methylsulfanyl-5-pyrrolidin-2-yl-1,2,4-triazole chloride |
| PubChem CID | 53314302 |
| Molecular Formula | C8H14ClN4S- |
| Molecular Weight | 233.75 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 4-methyl-3-methylsulfanyl-5-pyrrolidin-2-yl-1,2,4-triazole chloride |
| SMILES | CSc1nnc(C2CCCN2)n1C.[Cl-] |
| InChI | InChI=1S/C8H14N4S.ClH/c1-12-7(6-4-3-5-9-6)10-11-8(12)13-2;/h6,9H,3-5H2,1-2H3;1H/p-1 |
| InChIKey | LCVGCAQTVVXAIO-UHFFFAOYSA-M |
| XLogP | -2.03 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.75 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-3-methylsulfanyl-5-pyrrolidin-2-yl-1,2,4-triazole chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-methylsulfanyl-5-pyrrolidin-2-yl-1,2,4-triazole chloride?
The IUPAC name of 4-methyl-3-methylsulfanyl-5-pyrrolidin-2-yl-1,2,4-triazole chloride (CID 53314302) is 4-methyl-3-methylsulfanyl-5-pyrrolidin-2-yl-1,2,4-triazole chloride.
What is the SMILES notation for 4-methyl-3-methylsulfanyl-5-pyrrolidin-2-yl-1,2,4-triazole chloride?
The canonical SMILES for 4-methyl-3-methylsulfanyl-5-pyrrolidin-2-yl-1,2,4-triazole chloride is CSc1nnc(C2CCCN2)n1C.[Cl-].
What is the InChIKey of 4-methyl-3-methylsulfanyl-5-pyrrolidin-2-yl-1,2,4-triazole chloride?
The InChIKey is LCVGCAQTVVXAIO-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H14N4S.ClH/c1-12-7(6-4-3-5-9-6)10-11-8(12)13-2;/h6,9H,3-5H2,1-2H3;1H/p-1.
What are the key properties of 4-methyl-3-methylsulfanyl-5-pyrrolidin-2-yl-1,2,4-triazole chloride?
4-methyl-3-methylsulfanyl-5-pyrrolidin-2-yl-1,2,4-triazole chloride has a molecular weight of 233.75 g/mol, XLogP of -2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-methylsulfanyl-5-pyrrolidin-2-yl-1,2,4-triazole chloride is sourced from PubChem (CID 53314302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).