About 4-bromo-N,N-dibutylbenzamide
4-bromo-N,N-dibutylbenzamide (PubChem CID 533145) has the molecular formula C15H22BrNO
and a molecular weight of 312.25 g/mol. Its IUPAC name is 4-bromo-N,N-dibutylbenzamide.
Molecular Properties
| Compound Name | 4-bromo-N,N-dibutylbenzamide |
| PubChem CID | 533145 |
| Molecular Formula | C15H22BrNO |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-bromo-N,N-dibutylbenzamide |
| SMILES | CCCCN(CCCC)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H22BrNO/c1-3-5-11-17(12-6-4-2)15(18)13-7-9-14(16)10-8-13/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | WQPWOINOXVZQKN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-N,N-dibutylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N,N-dibutylbenzamide?
The IUPAC name of 4-bromo-N,N-dibutylbenzamide (CID 533145) is 4-bromo-N,N-dibutylbenzamide.
What is the SMILES notation for 4-bromo-N,N-dibutylbenzamide?
The canonical SMILES for 4-bromo-N,N-dibutylbenzamide is CCCCN(CCCC)C(=O)c1ccc(Br)cc1.
What is the InChIKey of 4-bromo-N,N-dibutylbenzamide?
The InChIKey is WQPWOINOXVZQKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22BrNO/c1-3-5-11-17(12-6-4-2)15(18)13-7-9-14(16)10-8-13/h7-10H,3-6,11-12H2,1-2H3.
What are the key properties of 4-bromo-N,N-dibutylbenzamide?
4-bromo-N,N-dibutylbenzamide has a molecular weight of 312.25 g/mol, XLogP of 4.49, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N,N-dibutylbenzamide is sourced from PubChem (CID 533145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).