About 4-[(E)-inden-1-ylidenemethyl]-1-N,1-N-dimethylbenzene-1,2-diamine
4-[(E)-inden-1-ylidenemethyl]-1-N,1-N-dimethylbenzene-1,2-diamine (PubChem CID 53315161) has the molecular formula C18H18N2
and a molecular weight of 262.36 g/mol. Its IUPAC name is 4-[(E)-inden-1-ylidenemethyl]-1-N,1-N-dimethylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | 4-[(E)-inden-1-ylidenemethyl]-1-N,1-N-dimethylbenzene-1,2-diamine |
| PubChem CID | 53315161 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4-[(E)-inden-1-ylidenemethyl]-1-N,1-N-dimethylbenzene-1,2-diamine |
| SMILES | CN(C)c1ccc(/C=C2\C=Cc3ccccc32)cc1N |
| InChI | InChI=1S/C18H18N2/c1-20(2)18-10-7-13(12-17(18)19)11-15-9-8-14-5-3-4-6-16(14)15/h3-12H,19H2,1-2H3/b15-11+ |
| InChIKey | GMMGDUYICFIGBW-RVDMUPIBSA-N |
| XLogP | 3.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-inden-1-ylidenemethyl]-1-N,1-N-dimethylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-inden-1-ylidenemethyl]-1-N,1-N-dimethylbenzene-1,2-diamine?
The IUPAC name of 4-[(E)-inden-1-ylidenemethyl]-1-N,1-N-dimethylbenzene-1,2-diamine (CID 53315161) is 4-[(E)-inden-1-ylidenemethyl]-1-N,1-N-dimethylbenzene-1,2-diamine.
What is the SMILES notation for 4-[(E)-inden-1-ylidenemethyl]-1-N,1-N-dimethylbenzene-1,2-diamine?
The canonical SMILES for 4-[(E)-inden-1-ylidenemethyl]-1-N,1-N-dimethylbenzene-1,2-diamine is CN(C)c1ccc(/C=C2\C=Cc3ccccc32)cc1N.
What is the InChIKey of 4-[(E)-inden-1-ylidenemethyl]-1-N,1-N-dimethylbenzene-1,2-diamine?
The InChIKey is GMMGDUYICFIGBW-RVDMUPIBSA-N. The full InChI is InChI=1S/C18H18N2/c1-20(2)18-10-7-13(12-17(18)19)11-15-9-8-14-5-3-4-6-16(14)15/h3-12H,19H2,1-2H3/b15-11+.
What are the key properties of 4-[(E)-inden-1-ylidenemethyl]-1-N,1-N-dimethylbenzene-1,2-diamine?
4-[(E)-inden-1-ylidenemethyl]-1-N,1-N-dimethylbenzene-1,2-diamine has a molecular weight of 262.36 g/mol, XLogP of 3.90, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-inden-1-ylidenemethyl]-1-N,1-N-dimethylbenzene-1,2-diamine is sourced from PubChem (CID 53315161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).