C15H20BrNO3S — CID 53315621
(5aS,9aS)-1-[(2-bromophenyl)methyl]-3,4,5a,6,7,8,9,9a-octahydrobenzo[f][1,4,5]oxathiazepine 2,2-dioxide (PubChem CID 53315621) has the molecular formula C15H20BrNO3S and a molecular weight of 374.30 g/mol. Its IUPAC name is (5aS,9aS)-1-[(2-bromophenyl)methyl]-3,4,5a,6,7,8,9,9a-octahydrobenzo[f][1,4,5]oxathiazepine 2,2-dioxide.
| Compound Name | (5aS,9aS)-1-[(2-bromophenyl)methyl]-3,4,5a,6,7,8,9,9a-octahydrobenzo[f][1,4,5]oxathiazepine 2,2-dioxide |
|---|---|
| PubChem CID | 53315621 |
| Molecular Formula | C15H20BrNO3S |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | (5aS,9aS)-1-[(2-bromophenyl)methyl]-3,4,5a,6,7,8,9,9a-octahydrobenzo[f][1,4,5]oxathiazepine 2,2-dioxide |
| SMILES | O=S1(=O)CCO[C@H]2CCCC[C@@H]2N1Cc1ccccc1Br |
| InChI | InChI=1S/C15H20BrNO3S/c16-13-6-2-1-5-12(13)11-17-14-7-3-4-8-15(14)20-9-10-21(17,18)19/h1-2,5-6,14-15H,3-4,7-11H2/t14-,15-/m0/s1 |
| InChIKey | RTYBTIFNLOXKEY-GJZGRUSLSA-N |
| XLogP | 2.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |