C16H23NO3S — CID 53315629
(5aS,9aS)-1-[(2-methylphenyl)methyl]-3,4,5a,6,7,8,9,9a-octahydrobenzo[f][1,4,5]oxathiazepine 2,2-dioxide (PubChem CID 53315629) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is (5aS,9aS)-1-[(2-methylphenyl)methyl]-3,4,5a,6,7,8,9,9a-octahydrobenzo[f][1,4,5]oxathiazepine 2,2-dioxide.
| Compound Name | (5aS,9aS)-1-[(2-methylphenyl)methyl]-3,4,5a,6,7,8,9,9a-octahydrobenzo[f][1,4,5]oxathiazepine 2,2-dioxide |
|---|---|
| PubChem CID | 53315629 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (5aS,9aS)-1-[(2-methylphenyl)methyl]-3,4,5a,6,7,8,9,9a-octahydrobenzo[f][1,4,5]oxathiazepine 2,2-dioxide |
| SMILES | Cc1ccccc1CN1[C@H]2CCCC[C@@H]2OCCS1(=O)=O |
| InChI | InChI=1S/C16H23NO3S/c1-13-6-2-3-7-14(13)12-17-15-8-4-5-9-16(15)20-10-11-21(17,18)19/h2-3,6-7,15-16H,4-5,8-12H2,1H3/t15-,16-/m0/s1 |
| InChIKey | JSHGGFYONQCMJS-HOTGVXAUSA-N |
| XLogP | 2.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |