C31H32N2O6 — CID 53315661
dimethyl (1S,4R)-1-[(2S,5S,7Z)-2,4-dibenzyl-3-oxo-2,5,6,9-tetrahydro-1H-1,4-diazonin-5-yl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 53315661) has the molecular formula C31H32N2O6 and a molecular weight of 528.61 g/mol. Its IUPAC name is dimethyl (1S,4R)-1-[(2S,5S,7Z)-2,4-dibenzyl-3-oxo-2,5,6,9-tetrahydro-1H-1,4-diazonin-5-yl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl (1S,4R)-1-[(2S,5S,7Z)-2,4-dibenzyl-3-oxo-2,5,6,9-tetrahydro-1H-1,4-diazonin-5-yl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 53315661 |
| Molecular Formula | C31H32N2O6 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | dimethyl (1S,4R)-1-[(2S,5S,7Z)-2,4-dibenzyl-3-oxo-2,5,6,9-tetrahydro-1H-1,4-diazonin-5-yl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@]2([C@@H]3C/C=C\CN[C@@H](Cc4ccccc4)C(=O)N3Cc3ccccc3)C=C[C@H]1O2 |
| InChI | InChI=1S/C31H32N2O6/c1-37-29(35)26-24-16-17-31(39-24,27(26)30(36)38-2)25-15-9-10-18-32-23(19-21-11-5-3-6-12-21)28(34)33(25)20-22-13-7-4-8-14-22/h3-14,16-17,23-25,32H,15,18-20H2,1-2H3/b10-9-/t23-,24+,25-,31+/m0/s1 |
| InChIKey | LVHSODJZDMKEQD-LFCZRDPNSA-N |
| XLogP | 2.89 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|