About CID 53315923
CID 53315923 (PubChem CID 53315923) has the molecular formula C35H31BrN4O8S
and a molecular weight of 747.62 g/mol.
Molecular Properties
| Compound Name | CID 53315923 |
| PubChem CID | 53315923 |
| Molecular Formula | C35H31BrN4O8S |
| Molecular Weight | 747.62 g/mol |
| Exact Mass | 746.10 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C2N(Cc3ccc(Br)cc3)c3ccccc3[C@@]23C[C@@H](C(=O)OC)N([S+](=O)([O-])c2ccc(C#N)cc2)C3=N1 |
| InChI | InChI=1S/C35H31BrN4O8S/c1-4-47-32(42)28-29(33(43)48-5-2)38-34-35(18-27(31(41)46-3)40(34)49(44,45)24-16-12-21(19-37)13-17-24)25-8-6-7-9-26(25)39(30(28)35)20-22-10-14-23(36)15-11-22/h6-17,27,30H,4-5,18,20H2,1-3H3/t27-,30?,35-/m0/s1 |
| InChIKey | ACNJHCQAEOWZLI-JYYAQMCHSA-N |
| XLogP | 4.59 |
| TPSA | 161.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 747.62 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 53315923 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 53315923?
The IUPAC name of CID 53315923 (CID 53315923) is not available.
What is the SMILES notation for CID 53315923?
The canonical SMILES for CID 53315923 is CCOC(=O)C1=C(C(=O)OCC)C2N(Cc3ccc(Br)cc3)c3ccccc3[C@@]23C[C@@H](C(=O)OC)N([S+](=O)([O-])c2ccc(C#N)cc2)C3=N1.
What is the InChIKey of CID 53315923?
The InChIKey is ACNJHCQAEOWZLI-JYYAQMCHSA-N. The full InChI is InChI=1S/C35H31BrN4O8S/c1-4-47-32(42)28-29(33(43)48-5-2)38-34-35(18-27(31(41)46-3)40(34)49(44,45)24-16-12-21(19-37)13-17-24)25-8-6-7-9-26(25)39(30(28)35)20-22-10-14-23(36)15-11-22/h6-17,27,30H,4-5,18,20H2,1-3H3/t27-,30?,35-/m0/s1.
What are the key properties of CID 53315923?
CID 53315923 has a molecular weight of 747.62 g/mol, XLogP of 4.59, 9 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 53315923 is sourced from PubChem (CID 53315923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).