About CID 53315932
CID 53315932 (PubChem CID 53315932) has the molecular formula C34H33F3N4O9S
and a molecular weight of 730.72 g/mol.
Molecular Properties
| Compound Name | CID 53315932 |
| PubChem CID | 53315932 |
| Molecular Formula | C34H33F3N4O9S |
| Molecular Weight | 730.72 g/mol |
| Exact Mass | 730.19 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C2N(Cc3ccc(C(F)(F)F)cc3)c3ccccc3[C@@]23C[C@@H](C(=O)OC)N([S+](=O)([O-])c2c(C)noc2C)C3=N1 |
| InChI | InChI=1S/C34H33F3N4O9S/c1-6-48-30(43)25-26(31(44)49-7-2)38-32-33(16-24(29(42)47-5)41(32)51(45,46)27-18(3)39-50-19(27)4)22-10-8-9-11-23(22)40(28(25)33)17-20-12-14-21(15-13-20)34(35,36)37/h8-15,24,28H,6-7,16-17H2,1-5H3/t24-,28?,33-/m0/s1 |
| InChIKey | BUVOSKQTMQLARD-KTMSYSMYSA-N |
| XLogP | 4.58 |
| TPSA | 163.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 730.72 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 53315932 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 53315932?
The IUPAC name of CID 53315932 (CID 53315932) is not available.
What is the SMILES notation for CID 53315932?
The canonical SMILES for CID 53315932 is CCOC(=O)C1=C(C(=O)OCC)C2N(Cc3ccc(C(F)(F)F)cc3)c3ccccc3[C@@]23C[C@@H](C(=O)OC)N([S+](=O)([O-])c2c(C)noc2C)C3=N1.
What is the InChIKey of CID 53315932?
The InChIKey is BUVOSKQTMQLARD-KTMSYSMYSA-N. The full InChI is InChI=1S/C34H33F3N4O9S/c1-6-48-30(43)25-26(31(44)49-7-2)38-32-33(16-24(29(42)47-5)41(32)51(45,46)27-18(3)39-50-19(27)4)22-10-8-9-11-23(22)40(28(25)33)17-20-12-14-21(15-13-20)34(35,36)37/h8-15,24,28H,6-7,16-17H2,1-5H3/t24-,28?,33-/m0/s1.
What are the key properties of CID 53315932?
CID 53315932 has a molecular weight of 730.72 g/mol, XLogP of 4.58, 9 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 53315932 is sourced from PubChem (CID 53315932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).