C36H31N5O8S — CID 53315944
10-O,11-O-diethyl 15-O-methyl (1S,15S)-8-[(4-cyanophenyl)methyl]-14-(4-cyanophenyl)sulfonyl-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate (PubChem CID 53315944) has the molecular formula C36H31N5O8S and a molecular weight of 693.74 g/mol. Its IUPAC name is 10-O,11-O-diethyl 15-O-methyl (1S,15S)-8-[(4-cyanophenyl)methyl]-14-(4-cyanophenyl)sulfonyl-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate.
| Compound Name | 10-O,11-O-diethyl 15-O-methyl (1S,15S)-8-[(4-cyanophenyl)methyl]-14-(4-cyanophenyl)sulfonyl-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate |
|---|---|
| PubChem CID | 53315944 |
| Molecular Formula | C36H31N5O8S |
| Molecular Weight | 693.74 g/mol |
| Exact Mass | 693.19 |
| IUPAC Name | 10-O,11-O-diethyl 15-O-methyl (1S,15S)-8-[(4-cyanophenyl)methyl]-14-(4-cyanophenyl)sulfonyl-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C2N(Cc3ccc(C#N)cc3)c3ccccc3[C@@]23C[C@@H](C(=O)OC)N(S(=O)(=O)c2ccc(C#N)cc2)C3=N1 |
| InChI | InChI=1S/C36H31N5O8S/c1-4-48-33(43)29-30(34(44)49-5-2)39-35-36(18-28(32(42)47-3)41(35)50(45,46)25-16-14-23(20-38)15-17-25)26-8-6-7-9-27(26)40(31(29)36)21-24-12-10-22(19-37)11-13-24/h6-17,28,31H,4-5,18,21H2,1-3H3/t28-,31?,36-/m0/s1 |
| InChIKey | IQYIDMLJXCXEGM-SUPQIXAGSA-N |
| XLogP | 3.49 |
| TPSA | 179.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.74 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|