About CID 53316310
CID 53316310 (PubChem CID 53316310) has the molecular formula C33H30F3N3O9S
and a molecular weight of 701.68 g/mol.
Molecular Properties
| Compound Name | CID 53316310 |
| PubChem CID | 53316310 |
| Molecular Formula | C33H30F3N3O9S |
| Molecular Weight | 701.68 g/mol |
| Exact Mass | 701.17 |
| IUPAC Name | — |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2N(Cc3ccccc3C(F)(F)F)c3ccccc3[C@@]23CC(C(=O)OC)N([S+](=O)([O-])c2c(C)noc2C)C3=C1 |
| InChI | InChI=1S/C33H30F3N3O9S/c1-17-27(18(2)48-37-17)49(43,44)39-24(30(41)46-4)15-32-22-12-8-9-13-23(22)38(16-19-10-6-7-11-21(19)33(34,35)36)28(32)26(31(42)47-5)20(14-25(32)39)29(40)45-3/h6-14,24,28H,15-16H2,1-5H3/t24?,28-,32+/m0/s1 |
| InChIKey | KCQMDDZBAZMHFA-WCNMPBTBSA-N |
| XLogP | 4.33 |
| TPSA | 151.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 701.68 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 53316310 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 53316310?
The IUPAC name of CID 53316310 (CID 53316310) is not available.
What is the SMILES notation for CID 53316310?
The canonical SMILES for CID 53316310 is COC(=O)C1=C(C(=O)OC)[C@@H]2N(Cc3ccccc3C(F)(F)F)c3ccccc3[C@@]23CC(C(=O)OC)N([S+](=O)([O-])c2c(C)noc2C)C3=C1.
What is the InChIKey of CID 53316310?
The InChIKey is KCQMDDZBAZMHFA-WCNMPBTBSA-N. The full InChI is InChI=1S/C33H30F3N3O9S/c1-17-27(18(2)48-37-17)49(43,44)39-24(30(41)46-4)15-32-22-12-8-9-13-23(22)38(16-19-10-6-7-11-21(19)33(34,35)36)28(32)26(31(42)47-5)20(14-25(32)39)29(40)45-3/h6-14,24,28H,15-16H2,1-5H3/t24?,28-,32+/m0/s1.
What are the key properties of CID 53316310?
CID 53316310 has a molecular weight of 701.68 g/mol, XLogP of 4.33, 7 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 53316310 is sourced from PubChem (CID 53316310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).