C9H10F3N2NaO7S2 — CID 53316464
sodium (2S,5R,6R)-3,3-dimethyl-4,4,7-trioxo-6-(trifluoromethylsulfonylamino)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 53316464) has the molecular formula C9H10F3N2NaO7S2 and a molecular weight of 402.30 g/mol. Its IUPAC name is sodium (2S,5R,6R)-3,3-dimethyl-4,4,7-trioxo-6-(trifluoromethylsulfonylamino)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6R)-3,3-dimethyl-4,4,7-trioxo-6-(trifluoromethylsulfonylamino)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 53316464 |
| Molecular Formula | C9H10F3N2NaO7S2 |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | sodium (2S,5R,6R)-3,3-dimethyl-4,4,7-trioxo-6-(trifluoromethylsulfonylamino)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)[O-])N2C(=O)[C@@H](NS(=O)(=O)C(F)(F)F)[C@H]2S1(=O)=O.[Na+] |
| InChI | InChI=1S/C9H11F3N2O7S2.Na/c1-8(2)4(7(16)17)14-5(15)3(6(14)22(8,18)19)13-23(20,21)9(10,11)12;/h3-4,6,13H,1-2H3,(H,16,17);/q;+1/p-1/t3-,4+,6-;/m1./s1 |
| InChIKey | GELAZYAFDUTRMU-ZXSAOVMCSA-M |
| XLogP | -5.71 |
| TPSA | 140.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | -5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |