C26H22F5N5O3 — CID 53316472
2-[2-[(4-cyclohexylphenyl)methylamino]-6-(2,3,4,5,6-pentafluorophenoxy)purin-9-yl]acetic acid (PubChem CID 53316472) has the molecular formula C26H22F5N5O3 and a molecular weight of 547.48 g/mol. Its IUPAC name is 2-[2-[(4-cyclohexylphenyl)methylamino]-6-(2,3,4,5,6-pentafluorophenoxy)purin-9-yl]acetic acid.
| Compound Name | 2-[2-[(4-cyclohexylphenyl)methylamino]-6-(2,3,4,5,6-pentafluorophenoxy)purin-9-yl]acetic acid |
|---|---|
| PubChem CID | 53316472 |
| Molecular Formula | C26H22F5N5O3 |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | 2-[2-[(4-cyclohexylphenyl)methylamino]-6-(2,3,4,5,6-pentafluorophenoxy)purin-9-yl]acetic acid |
| SMILES | O=C(O)Cn1cnc2c(Oc3c(F)c(F)c(F)c(F)c3F)nc(NCc3ccc(C4CCCCC4)cc3)nc21 |
| InChI | InChI=1S/C26H22F5N5O3/c27-17-18(28)20(30)23(21(31)19(17)29)39-25-22-24(36(12-33-22)11-16(37)38)34-26(35-25)32-10-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h6-9,12,14H,1-5,10-11H2,(H,37,38)(H,32,34,35) |
| InChIKey | LGNQSTMYRNTUKW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|