C19H18FNO — CID 5331678
(E)-3-(2-fluorophenyl)-1-(2-methyl-5,6,7,8-tetrahydroquinolin-3-yl)prop-2-en-1-one (PubChem CID 5331678) has the molecular formula C19H18FNO and a molecular weight of 295.36 g/mol. Its IUPAC name is (E)-3-(2-fluorophenyl)-1-(2-methyl-5,6,7,8-tetrahydroquinolin-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-fluorophenyl)-1-(2-methyl-5,6,7,8-tetrahydroquinolin-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 5331678 |
| Molecular Formula | C19H18FNO |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (E)-3-(2-fluorophenyl)-1-(2-methyl-5,6,7,8-tetrahydroquinolin-3-yl)prop-2-en-1-one |
| SMILES | Cc1nc2c(cc1C(=O)/C=C/c1ccccc1F)CCCC2 |
| InChI | InChI=1S/C19H18FNO/c1-13-16(12-15-7-3-5-9-18(15)21-13)19(22)11-10-14-6-2-4-8-17(14)20/h2,4,6,8,10-12H,3,5,7,9H2,1H3/b11-10+ |
| InChIKey | NRMSIMVNYDOYBH-ZHACJKMWSA-N |
| XLogP | 4.30 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|