About 2-chloro-N,N-dihexylacetamide
2-chloro-N,N-dihexylacetamide (PubChem CID 533169) has the molecular formula C14H28ClNO
and a molecular weight of 261.84 g/mol. Its IUPAC name is 2-chloro-N,N-dihexylacetamide.
Molecular Properties
| Compound Name | 2-chloro-N,N-dihexylacetamide |
| PubChem CID | 533169 |
| Molecular Formula | C14H28ClNO |
| Molecular Weight | 261.84 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | 2-chloro-N,N-dihexylacetamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)CCl |
| InChI | InChI=1S/C14H28ClNO/c1-3-5-7-9-11-16(14(17)13-15)12-10-8-6-4-2/h3-13H2,1-2H3 |
| InChIKey | ZGQVQRKCUZEQLW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.84 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N,N-dihexylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,N-dihexylacetamide?
The IUPAC name of 2-chloro-N,N-dihexylacetamide (CID 533169) is 2-chloro-N,N-dihexylacetamide.
What is the SMILES notation for 2-chloro-N,N-dihexylacetamide?
The canonical SMILES for 2-chloro-N,N-dihexylacetamide is CCCCCCN(CCCCCC)C(=O)CCl.
What is the InChIKey of 2-chloro-N,N-dihexylacetamide?
The InChIKey is ZGQVQRKCUZEQLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28ClNO/c1-3-5-7-9-11-16(14(17)13-15)12-10-8-6-4-2/h3-13H2,1-2H3.
What are the key properties of 2-chloro-N,N-dihexylacetamide?
2-chloro-N,N-dihexylacetamide has a molecular weight of 261.84 g/mol, XLogP of 4.21, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,N-dihexylacetamide is sourced from PubChem (CID 533169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).