C24H33N3O2 — CID 53317012
4-[4-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]methyl]triazol-1-yl]phenol (PubChem CID 53317012) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 4-[4-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]methyl]triazol-1-yl]phenol.
| Compound Name | 4-[4-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]methyl]triazol-1-yl]phenol |
|---|---|
| PubChem CID | 53317012 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 4-[4-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]methyl]triazol-1-yl]phenol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COCc1cn(-c2ccc(O)cc2)nn1 |
| InChI | InChI=1S/C24H33N3O2/c1-19(2)7-5-8-20(3)9-6-10-21(4)15-16-29-18-22-17-27(26-25-22)23-11-13-24(28)14-12-23/h7,9,11-15,17,28H,5-6,8,10,16,18H2,1-4H3/b20-9+,21-15+ |
| InChIKey | AYJKUHHZICKCOK-TVGRKTJDSA-N |
| XLogP | 5.91 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|