C15H12N2O — CID 53317111
6-(2-phenylethynyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine (PubChem CID 53317111) has the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. Its IUPAC name is 6-(2-phenylethynyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine.
| Compound Name | 6-(2-phenylethynyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine |
|---|---|
| PubChem CID | 53317111 |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 6-(2-phenylethynyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine |
| SMILES | C(#Cc1ccc2c(n1)OCCN2)c1ccccc1 |
| InChI | InChI=1S/C15H12N2O/c1-2-4-12(5-3-1)6-7-13-8-9-14-15(17-13)18-11-10-16-14/h1-5,8-9,16H,10-11H2 |
| InChIKey | YNDZEMICBJAWPH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|