C10H14FNaO14P2 — CID 53317223
sodium (3R,4S,5R)-5-[(1S)-1-carboxy-2-fluoro-1-phosphonooxyethoxy]-4-hydroxy-3-phosphonooxycyclohexene-1-carboxylate (PubChem CID 53317223) has the molecular formula C10H14FNaO14P2 and a molecular weight of 462.14 g/mol. Its IUPAC name is sodium (3R,4S,5R)-5-[(1S)-1-carboxy-2-fluoro-1-phosphonooxyethoxy]-4-hydroxy-3-phosphonooxycyclohexene-1-carboxylate.
| Compound Name | sodium (3R,4S,5R)-5-[(1S)-1-carboxy-2-fluoro-1-phosphonooxyethoxy]-4-hydroxy-3-phosphonooxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 53317223 |
| Molecular Formula | C10H14FNaO14P2 |
| Molecular Weight | 462.14 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | sodium (3R,4S,5R)-5-[(1S)-1-carboxy-2-fluoro-1-phosphonooxyethoxy]-4-hydroxy-3-phosphonooxycyclohexene-1-carboxylate |
| SMILES | O=C([O-])C1=C[C@@H](OP(=O)(O)O)[C@@H](O)[C@H](O[C@](CF)(OP(=O)(O)O)C(=O)O)C1.[Na+] |
| InChI | InChI=1S/C10H15FO14P2.Na/c11-3-10(9(15)16,25-27(20,21)22)23-5-1-4(8(13)14)2-6(7(5)12)24-26(17,18)19;/h2,5-7,12H,1,3H2,(H,13,14)(H,15,16)(H2,17,18,19)(H2,20,21,22);/q;+1/p-1/t5-,6-,7+,10-;/m1./s1 |
| InChIKey | OEQXOWGCWNPOLH-NDGFODGGSA-M |
| XLogP | -5.85 |
| TPSA | 240.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.14 |
| LogP ≤ 5 | -5.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|