About 2-(4-chlorophenyl)-3-[(2-chlorophenyl)methoxy]pyrazolo[4,3-c]quinoline
2-(4-chlorophenyl)-3-[(2-chlorophenyl)methoxy]pyrazolo[4,3-c]quinoline (PubChem CID 53317278) has the molecular formula C23H15Cl2N3O
and a molecular weight of 420.30 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-[(2-chlorophenyl)methoxy]pyrazolo[4,3-c]quinoline.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-3-[(2-chlorophenyl)methoxy]pyrazolo[4,3-c]quinoline |
| PubChem CID | 53317278 |
| Molecular Formula | C23H15Cl2N3O |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 2-(4-chlorophenyl)-3-[(2-chlorophenyl)methoxy]pyrazolo[4,3-c]quinoline |
| SMILES | Clc1ccc(-n2nc3c(cnc4ccccc43)c2OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H15Cl2N3O/c24-16-9-11-17(12-10-16)28-23(29-14-15-5-1-3-7-20(15)25)19-13-26-21-8-4-2-6-18(21)22(19)27-28/h1-13H,14H2 |
| InChIKey | SOCJQMROXJKCQV-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-chlorophenyl)-3-[(2-chlorophenyl)methoxy]pyrazolo[4,3-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-3-[(2-chlorophenyl)methoxy]pyrazolo[4,3-c]quinoline?
The IUPAC name of 2-(4-chlorophenyl)-3-[(2-chlorophenyl)methoxy]pyrazolo[4,3-c]quinoline (CID 53317278) is 2-(4-chlorophenyl)-3-[(2-chlorophenyl)methoxy]pyrazolo[4,3-c]quinoline.
What is the SMILES notation for 2-(4-chlorophenyl)-3-[(2-chlorophenyl)methoxy]pyrazolo[4,3-c]quinoline?
The canonical SMILES for 2-(4-chlorophenyl)-3-[(2-chlorophenyl)methoxy]pyrazolo[4,3-c]quinoline is Clc1ccc(-n2nc3c(cnc4ccccc43)c2OCc2ccccc2Cl)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-3-[(2-chlorophenyl)methoxy]pyrazolo[4,3-c]quinoline?
The InChIKey is SOCJQMROXJKCQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15Cl2N3O/c24-16-9-11-17(12-10-16)28-23(29-14-15-5-1-3-7-20(15)25)19-13-26-21-8-4-2-6-18(21)22(19)27-28/h1-13H,14H2.
What are the key properties of 2-(4-chlorophenyl)-3-[(2-chlorophenyl)methoxy]pyrazolo[4,3-c]quinoline?
2-(4-chlorophenyl)-3-[(2-chlorophenyl)methoxy]pyrazolo[4,3-c]quinoline has a molecular weight of 420.30 g/mol, XLogP of 6.46, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-3-[(2-chlorophenyl)methoxy]pyrazolo[4,3-c]quinoline is sourced from PubChem (CID 53317278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).