C22H31FO3 — CID 53317288
(8S,9S,11R,13S,14S,17S)-11-[2-(2-fluoroethoxy)ethyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 53317288) has the molecular formula C22H31FO3 and a molecular weight of 362.49 g/mol. Its IUPAC name is (8S,9S,11R,13S,14S,17S)-11-[2-(2-fluoroethoxy)ethyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,9S,11R,13S,14S,17S)-11-[2-(2-fluoroethoxy)ethyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 53317288 |
| Molecular Formula | C22H31FO3 |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | (8S,9S,11R,13S,14S,17S)-11-[2-(2-fluoroethoxy)ethyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12C[C@H](CCOCCF)[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C22H31FO3/c1-22-13-15(8-10-26-11-9-23)21-17-5-3-16(24)12-14(17)2-4-18(21)19(22)6-7-20(22)25/h3,5,12,15,18-21,24-25H,2,4,6-11,13H2,1H3/t15-,18-,19-,20-,21+,22-/m0/s1 |
| InChIKey | NHMZVMVWBFWDCK-USUWBSJTSA-N |
| XLogP | 4.21 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|