C13H24O6 — CID 53317376
ethyl 2-[(3R,4S,5R,6S)-4,5-dihydroxy-6-pentyldioxan-3-yl]acetate (PubChem CID 53317376) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is ethyl 2-[(3R,4S,5R,6S)-4,5-dihydroxy-6-pentyldioxan-3-yl]acetate.
| Compound Name | ethyl 2-[(3R,4S,5R,6S)-4,5-dihydroxy-6-pentyldioxan-3-yl]acetate |
|---|---|
| PubChem CID | 53317376 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | ethyl 2-[(3R,4S,5R,6S)-4,5-dihydroxy-6-pentyldioxan-3-yl]acetate |
| SMILES | CCCCC[C@@H]1OO[C@H](CC(=O)OCC)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H24O6/c1-3-5-6-7-9-12(15)13(16)10(19-18-9)8-11(14)17-4-2/h9-10,12-13,15-16H,3-8H2,1-2H3/t9-,10+,12-,13+/m0/s1 |
| InChIKey | FCNXMMUAOIUZAC-JULQROHOSA-N |
| XLogP | 0.94 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|