About 1-anilino-N'-(benzenesulfonyl)-5-methyltriazole-4-carbohydrazide
1-anilino-N'-(benzenesulfonyl)-5-methyltriazole-4-carbohydrazide (PubChem CID 53317384) has the molecular formula C16H16N6O3S
and a molecular weight of 372.41 g/mol. Its IUPAC name is 1-anilino-N'-(benzenesulfonyl)-5-methyltriazole-4-carbohydrazide.
Molecular Properties
| Compound Name | 1-anilino-N'-(benzenesulfonyl)-5-methyltriazole-4-carbohydrazide |
| PubChem CID | 53317384 |
| Molecular Formula | C16H16N6O3S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 1-anilino-N'-(benzenesulfonyl)-5-methyltriazole-4-carbohydrazide |
| SMILES | Cc1c(C(=O)NNS(=O)(=O)c2ccccc2)nnn1Nc1ccccc1 |
| InChI | InChI=1S/C16H16N6O3S/c1-12-15(17-20-22(12)19-13-8-4-2-5-9-13)16(23)18-21-26(24,25)14-10-6-3-7-11-14/h2-11,19,21H,1H3,(H,18,23) |
| InChIKey | SDPXVGPCLGUINX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-anilino-N'-(benzenesulfonyl)-5-methyltriazole-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-anilino-N'-(benzenesulfonyl)-5-methyltriazole-4-carbohydrazide?
The IUPAC name of 1-anilino-N'-(benzenesulfonyl)-5-methyltriazole-4-carbohydrazide (CID 53317384) is 1-anilino-N'-(benzenesulfonyl)-5-methyltriazole-4-carbohydrazide.
What is the SMILES notation for 1-anilino-N'-(benzenesulfonyl)-5-methyltriazole-4-carbohydrazide?
The canonical SMILES for 1-anilino-N'-(benzenesulfonyl)-5-methyltriazole-4-carbohydrazide is Cc1c(C(=O)NNS(=O)(=O)c2ccccc2)nnn1Nc1ccccc1.
What is the InChIKey of 1-anilino-N'-(benzenesulfonyl)-5-methyltriazole-4-carbohydrazide?
The InChIKey is SDPXVGPCLGUINX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N6O3S/c1-12-15(17-20-22(12)19-13-8-4-2-5-9-13)16(23)18-21-26(24,25)14-10-6-3-7-11-14/h2-11,19,21H,1H3,(H,18,23).
What are the key properties of 1-anilino-N'-(benzenesulfonyl)-5-methyltriazole-4-carbohydrazide?
1-anilino-N'-(benzenesulfonyl)-5-methyltriazole-4-carbohydrazide has a molecular weight of 372.41 g/mol, XLogP of 1.09, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-anilino-N'-(benzenesulfonyl)-5-methyltriazole-4-carbohydrazide is sourced from PubChem (CID 53317384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).