C32H35FN2O10 — CID 53317392
(2R,4S,5R,6R)-6-[(1R,2R)-3-[[2-[4-(4-fluorophenyl)phenyl]acetyl]amino]-1,2-dihydroxypropyl]-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-phenylmethoxyoxane-2-carboxylic acid (PubChem CID 53317392) has the molecular formula C32H35FN2O10 and a molecular weight of 626.63 g/mol. Its IUPAC name is (2R,4S,5R,6R)-6-[(1R,2R)-3-[[2-[4-(4-fluorophenyl)phenyl]acetyl]amino]-1,2-dihydroxypropyl]-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-phenylmethoxyoxane-2-carboxylic acid.
| Compound Name | (2R,4S,5R,6R)-6-[(1R,2R)-3-[[2-[4-(4-fluorophenyl)phenyl]acetyl]amino]-1,2-dihydroxypropyl]-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-phenylmethoxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 53317392 |
| Molecular Formula | C32H35FN2O10 |
| Molecular Weight | 626.63 g/mol |
| Exact Mass | 626.23 |
| IUPAC Name | (2R,4S,5R,6R)-6-[(1R,2R)-3-[[2-[4-(4-fluorophenyl)phenyl]acetyl]amino]-1,2-dihydroxypropyl]-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-phenylmethoxyoxane-2-carboxylic acid |
| SMILES | O=C(Cc1ccc(-c2ccc(F)cc2)cc1)NC[C@@H](O)[C@@H](O)[C@@H]1O[C@@](OCc2ccccc2)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO |
| InChI | InChI=1S/C32H35FN2O10/c33-23-12-10-22(11-13-23)21-8-6-19(7-9-21)14-26(39)34-16-25(38)29(41)30-28(35-27(40)17-36)24(37)15-32(45-30,31(42)43)44-18-20-4-2-1-3-5-20/h1-13,24-25,28-30,36-38,41H,14-18H2,(H,34,39)(H,35,40)(H,42,43)/t24-,25+,28+,29+,30+,32+/m0/s1 |
| InChIKey | JMZMXLMDTBVUHO-OVRIQYAISA-N |
| XLogP | 0.50 |
| TPSA | 194.88 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.63 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |