About 2-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-6-(2-cyanophenyl)pyridine-4-carbonitrile
2-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-6-(2-cyanophenyl)pyridine-4-carbonitrile (PubChem CID 53317411) has the molecular formula C20H18N4O
and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-6-(2-cyanophenyl)pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-6-(2-cyanophenyl)pyridine-4-carbonitrile |
| PubChem CID | 53317411 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-6-(2-cyanophenyl)pyridine-4-carbonitrile |
| SMILES | N#Cc1cc(OC2C[C@H]3CC[C@@H](C2)N3)nc(-c2ccccc2C#N)c1 |
| InChI | InChI=1S/C20H18N4O/c21-11-13-7-19(18-4-2-1-3-14(18)12-22)24-20(8-13)25-17-9-15-5-6-16(10-17)23-15/h1-4,7-8,15-17,23H,5-6,9-10H2/t15-,16+,17? |
| InChIKey | QOSPLNXOHCYGSB-SJPCQFCGSA-N |
| XLogP | 3.15 |
| TPSA | 81.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-6-(2-cyanophenyl)pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-6-(2-cyanophenyl)pyridine-4-carbonitrile?
The IUPAC name of 2-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-6-(2-cyanophenyl)pyridine-4-carbonitrile (CID 53317411) is 2-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-6-(2-cyanophenyl)pyridine-4-carbonitrile.
What is the SMILES notation for 2-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-6-(2-cyanophenyl)pyridine-4-carbonitrile?
The canonical SMILES for 2-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-6-(2-cyanophenyl)pyridine-4-carbonitrile is N#Cc1cc(OC2C[C@H]3CC[C@@H](C2)N3)nc(-c2ccccc2C#N)c1.
What is the InChIKey of 2-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-6-(2-cyanophenyl)pyridine-4-carbonitrile?
The InChIKey is QOSPLNXOHCYGSB-SJPCQFCGSA-N. The full InChI is InChI=1S/C20H18N4O/c21-11-13-7-19(18-4-2-1-3-14(18)12-22)24-20(8-13)25-17-9-15-5-6-16(10-17)23-15/h1-4,7-8,15-17,23H,5-6,9-10H2/t15-,16+,17?.
What are the key properties of 2-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-6-(2-cyanophenyl)pyridine-4-carbonitrile?
2-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-6-(2-cyanophenyl)pyridine-4-carbonitrile has a molecular weight of 330.39 g/mol, XLogP of 3.15, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-6-(2-cyanophenyl)pyridine-4-carbonitrile is sourced from PubChem (CID 53317411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).