C22H30ClNO5S — CID 53317450
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-hexyl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 53317450) has the molecular formula C22H30ClNO5S and a molecular weight of 456.00 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-hexyl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-hexyl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53317450 |
| Molecular Formula | C22H30ClNO5S |
| Molecular Weight | 456.00 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-hexyl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCCCCc1cnc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)C3O)ccc2Cl)s1 |
| InChI | InChI=1S/C22H30ClNO5S/c1-2-3-4-5-6-15-11-24-18(30-15)10-14-9-13(7-8-16(14)23)22-21(28)20(27)19(26)17(12-25)29-22/h7-9,11,17,19-22,25-28H,2-6,10,12H2,1H3/t17-,19-,20+,21?,22+/m1/s1 |
| InChIKey | SZPXRYYNSRDUBE-LAJURYSTSA-N |
| XLogP | 3.03 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.00 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|