C18H18ClN3O5S2 — CID 53317453
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(1,3,4-thiadiazol-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 53317453) has the molecular formula C18H18ClN3O5S2 and a molecular weight of 455.95 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(1,3,4-thiadiazol-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(1,3,4-thiadiazol-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53317453 |
| Molecular Formula | C18H18ClN3O5S2 |
| Molecular Weight | 455.95 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(1,3,4-thiadiazol-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ncc(-c4nncs4)s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H18ClN3O5S2/c19-10-2-1-8(17-16(26)15(25)14(24)11(6-23)27-17)3-9(10)4-13-20-5-12(29-13)18-22-21-7-28-18/h1-3,5,7,11,14-17,23-26H,4,6H2/t11-,14-,15+,16-,17+/m1/s1 |
| InChIKey | VYAFXJBPXOETOY-UFRBAHOGSA-N |
| XLogP | 1.42 |
| TPSA | 128.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.95 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |