C25H34FN6O9P — CID 53317514
ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(2-methoxyethoxy)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 53317514) has the molecular formula C25H34FN6O9P and a molecular weight of 612.55 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(2-methoxyethoxy)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(2-methoxyethoxy)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 53317514 |
| Molecular Formula | C25H34FN6O9P |
| Molecular Weight | 612.55 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(2-methoxyethoxy)purin-9-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(OCCOC)nc(N)nc32)[C@](C)(F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C25H34FN6O9P/c1-5-37-22(34)15(2)31-42(35,41-16-9-7-6-8-10-16)39-13-17-19(33)25(3,26)23(40-17)32-14-28-18-20(32)29-24(27)30-21(18)38-12-11-36-4/h6-10,14-15,17,19,23,33H,5,11-13H2,1-4H3,(H,31,35)(H2,27,29,30)/t15-,17+,19+,23+,25+,42?/m0/s1 |
| InChIKey | DJQLPEZRDWSAET-UFGIKPJJSA-N |
| XLogP | 2.17 |
| TPSA | 191.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.55 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|