C15H19N5O2S — CID 53317521
(2R,3R,4S)-2-(6-amino-8-hex-1-ynylpurin-9-yl)thiolane-3,4-diol (PubChem CID 53317521) has the molecular formula C15H19N5O2S and a molecular weight of 333.42 g/mol. Its IUPAC name is (2R,3R,4S)-2-(6-amino-8-hex-1-ynylpurin-9-yl)thiolane-3,4-diol.
| Compound Name | (2R,3R,4S)-2-(6-amino-8-hex-1-ynylpurin-9-yl)thiolane-3,4-diol |
|---|---|
| PubChem CID | 53317521 |
| Molecular Formula | C15H19N5O2S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | (2R,3R,4S)-2-(6-amino-8-hex-1-ynylpurin-9-yl)thiolane-3,4-diol |
| SMILES | CCCCC#Cc1nc2c(N)ncnc2n1[C@@H]1SC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H19N5O2S/c1-2-3-4-5-6-10-19-11-13(16)17-8-18-14(11)20(10)15-12(22)9(21)7-23-15/h8-9,12,15,21-22H,2-4,7H2,1H3,(H2,16,17,18)/t9-,12-,15-/m1/s1 |
| InChIKey | FATRRHZCCXPNJR-DDHOLCJHSA-N |
| XLogP | 0.92 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|