About N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-methylacetamide
N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-methylacetamide (PubChem CID 53317575) has the molecular formula C17H24F2N2O
and a molecular weight of 310.39 g/mol. Its IUPAC name is N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-methylacetamide.
Molecular Properties
| Compound Name | N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-methylacetamide |
| PubChem CID | 53317575 |
| Molecular Formula | C17H24F2N2O |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)C1CCC([C@H](N)Cc2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C17H24F2N2O/c1-11(22)21(2)15-6-3-12(4-7-15)17(20)10-13-9-14(18)5-8-16(13)19/h5,8-9,12,15,17H,3-4,6-7,10,20H2,1-2H3/t12?,15?,17-/m1/s1 |
| InChIKey | ONALMBFBMOZHSN-MWHAMWOXSA-N |
| XLogP | 2.87 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-methylacetamide?
The IUPAC name of N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-methylacetamide (CID 53317575) is N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-methylacetamide.
What is the SMILES notation for N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-methylacetamide?
The canonical SMILES for N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-methylacetamide is CC(=O)N(C)C1CCC([C@H](N)Cc2cc(F)ccc2F)CC1.
What is the InChIKey of N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-methylacetamide?
The InChIKey is ONALMBFBMOZHSN-MWHAMWOXSA-N. The full InChI is InChI=1S/C17H24F2N2O/c1-11(22)21(2)15-6-3-12(4-7-15)17(20)10-13-9-14(18)5-8-16(13)19/h5,8-9,12,15,17H,3-4,6-7,10,20H2,1-2H3/t12?,15?,17-/m1/s1.
What are the key properties of N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-methylacetamide?
N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-methylacetamide has a molecular weight of 310.39 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-methylacetamide is sourced from PubChem (CID 53317575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).