C20H24F5N5 — CID 53317579
(1R)-2-(2,5-difluorophenyl)-1-[4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]cyclohexyl]ethanamine (PubChem CID 53317579) has the molecular formula C20H24F5N5 and a molecular weight of 429.44 g/mol. Its IUPAC name is (1R)-2-(2,5-difluorophenyl)-1-[4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]cyclohexyl]ethanamine.
| Compound Name | (1R)-2-(2,5-difluorophenyl)-1-[4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]cyclohexyl]ethanamine |
|---|---|
| PubChem CID | 53317579 |
| Molecular Formula | C20H24F5N5 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | (1R)-2-(2,5-difluorophenyl)-1-[4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]cyclohexyl]ethanamine |
| SMILES | N[C@H](Cc1cc(F)ccc1F)C1CCC(N2CCn3c(nnc3C(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C20H24F5N5/c21-14-3-6-16(22)13(9-14)10-17(26)12-1-4-15(5-2-12)29-7-8-30-18(11-29)27-28-19(30)20(23,24)25/h3,6,9,12,15,17H,1-2,4-5,7-8,10-11,26H2/t12?,15?,17-/m1/s1 |
| InChIKey | DMNMXJKWEZEVSV-MWHAMWOXSA-N |
| XLogP | 3.52 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |