About ethyl 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate
ethyl 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate (PubChem CID 53317582) has the molecular formula C21H25F2N3O2
and a molecular weight of 389.45 g/mol. Its IUPAC name is ethyl 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate |
| PubChem CID | 53317582 |
| Molecular Formula | C21H25F2N3O2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | ethyl 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cncc(N2CCC([C@H](N)Cc3cc(F)ccc3F)CC2)c1 |
| InChI | InChI=1S/C21H25F2N3O2/c1-2-28-21(27)16-10-18(13-25-12-16)26-7-5-14(6-8-26)20(24)11-15-9-17(22)3-4-19(15)23/h3-4,9-10,12-14,20H,2,5-8,11,24H2,1H3/t20-/m1/s1 |
| InChIKey | WORSZPDWEGVQNR-HXUWFJFHSA-N |
| XLogP | 3.32 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate?
The IUPAC name of ethyl 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate (CID 53317582) is ethyl 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate.
What is the SMILES notation for ethyl 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate?
The canonical SMILES for ethyl 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate is CCOC(=O)c1cncc(N2CCC([C@H](N)Cc3cc(F)ccc3F)CC2)c1.
What is the InChIKey of ethyl 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate?
The InChIKey is WORSZPDWEGVQNR-HXUWFJFHSA-N. The full InChI is InChI=1S/C21H25F2N3O2/c1-2-28-21(27)16-10-18(13-25-12-16)26-7-5-14(6-8-26)20(24)11-15-9-17(22)3-4-19(15)23/h3-4,9-10,12-14,20H,2,5-8,11,24H2,1H3/t20-/m1/s1.
What are the key properties of ethyl 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate?
ethyl 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate has a molecular weight of 389.45 g/mol, XLogP of 3.32, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate is sourced from PubChem (CID 53317582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).