About N,N-dibutyl-2,2,2-trichloroacetamide
N,N-dibutyl-2,2,2-trichloroacetamide (PubChem CID 533176) has the molecular formula C10H18Cl3NO
and a molecular weight of 274.62 g/mol. Its IUPAC name is N,N-dibutyl-2,2,2-trichloroacetamide.
Molecular Properties
| Compound Name | N,N-dibutyl-2,2,2-trichloroacetamide |
| PubChem CID | 533176 |
| Molecular Formula | C10H18Cl3NO |
| Molecular Weight | 274.62 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | N,N-dibutyl-2,2,2-trichloroacetamide |
| SMILES | CCCCN(CCCC)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H18Cl3NO/c1-3-5-7-14(8-6-4-2)9(15)10(11,12)13/h3-8H2,1-2H3 |
| InChIKey | XAPJKGWLPPCTDF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.62 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibutyl-2,2,2-trichloroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutyl-2,2,2-trichloroacetamide?
The IUPAC name of N,N-dibutyl-2,2,2-trichloroacetamide (CID 533176) is N,N-dibutyl-2,2,2-trichloroacetamide.
What is the SMILES notation for N,N-dibutyl-2,2,2-trichloroacetamide?
The canonical SMILES for N,N-dibutyl-2,2,2-trichloroacetamide is CCCCN(CCCC)C(=O)C(Cl)(Cl)Cl.
What is the InChIKey of N,N-dibutyl-2,2,2-trichloroacetamide?
The InChIKey is XAPJKGWLPPCTDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18Cl3NO/c1-3-5-7-14(8-6-4-2)9(15)10(11,12)13/h3-8H2,1-2H3.
What are the key properties of N,N-dibutyl-2,2,2-trichloroacetamide?
N,N-dibutyl-2,2,2-trichloroacetamide has a molecular weight of 274.62 g/mol, XLogP of 3.79, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutyl-2,2,2-trichloroacetamide is sourced from PubChem (CID 533176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).