C18H18F3N5O — CID 53317627
1-[(3S,4S)-4-amino-1-[6-(2,4,5-trifluorophenyl)pyrimidin-4-yl]pyrrolidin-3-yl]pyrrolidin-2-one (PubChem CID 53317627) has the molecular formula C18H18F3N5O and a molecular weight of 377.37 g/mol. Its IUPAC name is 1-[(3S,4S)-4-amino-1-[6-(2,4,5-trifluorophenyl)pyrimidin-4-yl]pyrrolidin-3-yl]pyrrolidin-2-one.
| Compound Name | 1-[(3S,4S)-4-amino-1-[6-(2,4,5-trifluorophenyl)pyrimidin-4-yl]pyrrolidin-3-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 53317627 |
| Molecular Formula | C18H18F3N5O |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 1-[(3S,4S)-4-amino-1-[6-(2,4,5-trifluorophenyl)pyrimidin-4-yl]pyrrolidin-3-yl]pyrrolidin-2-one |
| SMILES | N[C@H]1CN(c2cc(-c3cc(F)c(F)cc3F)ncn2)C[C@@H]1N1CCCC1=O |
| InChI | InChI=1S/C18H18F3N5O/c19-11-5-13(21)12(20)4-10(11)15-6-17(24-9-23-15)25-7-14(22)16(8-25)26-3-1-2-18(26)27/h4-6,9,14,16H,1-3,7-8,22H2/t14-,16-/m0/s1 |
| InChIKey | AHMISODBMDDBSB-HOCLYGCPSA-N |
| XLogP | 1.70 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|