C16H13ClN4O2 — CID 53317656
(3E)-7-chloro-3-[(pyridin-4-ylmethylamino)methylidene]-1,5-dihydro-1,5-benzodiazepine-2,4-dione (PubChem CID 53317656) has the molecular formula C16H13ClN4O2 and a molecular weight of 328.76 g/mol. Its IUPAC name is (3E)-7-chloro-3-[(pyridin-4-ylmethylamino)methylidene]-1,5-dihydro-1,5-benzodiazepine-2,4-dione.
| Compound Name | (3E)-7-chloro-3-[(pyridin-4-ylmethylamino)methylidene]-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 53317656 |
| Molecular Formula | C16H13ClN4O2 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (3E)-7-chloro-3-[(pyridin-4-ylmethylamino)methylidene]-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
| SMILES | O=C1Nc2ccc(Cl)cc2NC(=O)/C1=C/NCc1ccncc1 |
| InChI | InChI=1S/C16H13ClN4O2/c17-11-1-2-13-14(7-11)21-16(23)12(15(22)20-13)9-19-8-10-3-5-18-6-4-10/h1-7,9,19H,8H2,(H,20,22)(H,21,23)/b12-9+ |
| InChIKey | IEVCVSGUDOWWOA-FMIVXFBMSA-N |
| XLogP | 2.30 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|