C12H13ClN2O4S — CID 53317745
(2R)-2-acetamido-3-[(3-chlorophenyl)carbamoylsulfanyl]propanoic acid (PubChem CID 53317745) has the molecular formula C12H13ClN2O4S and a molecular weight of 316.77 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[(3-chlorophenyl)carbamoylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-acetamido-3-[(3-chlorophenyl)carbamoylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 53317745 |
| Molecular Formula | C12H13ClN2O4S |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | (2R)-2-acetamido-3-[(3-chlorophenyl)carbamoylsulfanyl]propanoic acid |
| SMILES | CC(=O)N[C@@H](CSC(=O)Nc1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C12H13ClN2O4S/c1-7(16)14-10(11(17)18)6-20-12(19)15-9-4-2-3-8(13)5-9/h2-5,10H,6H2,1H3,(H,14,16)(H,15,19)(H,17,18)/t10-/m0/s1 |
| InChIKey | CRRPJNSXAFJTCY-JTQLQIEISA-N |
| XLogP | 2.19 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|